C17H27Cl3N2 — CID 171281574
1-[(S)-(4-chlorophenyl)-cyclohexylmethyl]piperazine;dihydrochloride (PubChem CID 171281574) has the molecular formula C17H27Cl3N2 and a molecular weight of 365.78 g/mol. Its IUPAC name is 1-[(S)-(4-chlorophenyl)-cyclohexylmethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(S)-(4-chlorophenyl)-cyclohexylmethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171281574 |
| Molecular Formula | C17H27Cl3N2 |
| Molecular Weight | 365.78 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 1-[(S)-(4-chlorophenyl)-cyclohexylmethyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.Clc1ccc(C(C2CCCCC2)N2CCNCC2)cc1 |
| InChI | InChI=1S/C17H25ClN2.2ClH/c18-16-8-6-15(7-9-16)17(14-4-2-1-3-5-14)20-12-10-19-11-13-20;;/h6-9,14,17,19H,1-5,10-13H2;2*1H |
| InChIKey | ZCLFAXDKDKNJNZ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.78 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |