C16H22ClF3N2 — CID 171179871
1-[(S)-cyclobutyl-[3-(trifluoromethyl)phenyl]methyl]piperazine;hydrochloride (PubChem CID 171179871) has the molecular formula C16H22ClF3N2 and a molecular weight of 334.81 g/mol. Its IUPAC name is 1-[(S)-cyclobutyl-[3-(trifluoromethyl)phenyl]methyl]piperazine;hydrochloride.
| Compound Name | 1-[(S)-cyclobutyl-[3-(trifluoromethyl)phenyl]methyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171179871 |
| Molecular Formula | C16H22ClF3N2 |
| Molecular Weight | 334.81 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 1-[(S)-cyclobutyl-[3-(trifluoromethyl)phenyl]methyl]piperazine;hydrochloride |
| SMILES | Cl.FC(F)(F)c1cccc([C@H](C2CCC2)N2CCNCC2)c1 |
| InChI | InChI=1S/C16H21F3N2.ClH/c17-16(18,19)14-6-2-5-13(11-14)15(12-3-1-4-12)21-9-7-20-8-10-21;/h2,5-6,11-12,15,20H,1,3-4,7-10H2;1H/t15-;/m0./s1 |
| InChIKey | WYKYXDMZZCAJSZ-RSAXXLAASA-N |
| XLogP | 3.87 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.81 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |