C23H27F3N2 — CID 171166981
1-[(S)-cyclopentyl-[4-[4-(trifluoromethyl)phenyl]phenyl]methyl]piperazine (PubChem CID 171166981) has the molecular formula C23H27F3N2 and a molecular weight of 388.48 g/mol. Its IUPAC name is 1-[(S)-cyclopentyl-[4-[4-(trifluoromethyl)phenyl]phenyl]methyl]piperazine.
| Compound Name | 1-[(S)-cyclopentyl-[4-[4-(trifluoromethyl)phenyl]phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 171166981 |
| Molecular Formula | C23H27F3N2 |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | 1-[(S)-cyclopentyl-[4-[4-(trifluoromethyl)phenyl]phenyl]methyl]piperazine |
| SMILES | FC(F)(F)c1ccc(-c2ccc([C@H](C3CCCC3)N3CCNCC3)cc2)cc1 |
| InChI | InChI=1S/C23H27F3N2/c24-23(25,26)21-11-9-18(10-12-21)17-5-7-20(8-6-17)22(19-3-1-2-4-19)28-15-13-27-14-16-28/h5-12,19,22,27H,1-4,13-16H2/t22-/m0/s1 |
| InChIKey | XWMDCTQQJFTOPJ-QFIPXVFZSA-N |
| XLogP | 5.51 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |