C18H26Cl2F4N2O — CID 171292277
1-[(R)-cyclopentyl-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]piperazine;dihydrochloride (PubChem CID 171292277) has the molecular formula C18H26Cl2F4N2O and a molecular weight of 433.32 g/mol. Its IUPAC name is 1-[(R)-cyclopentyl-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(R)-cyclopentyl-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171292277 |
| Molecular Formula | C18H26Cl2F4N2O |
| Molecular Weight | 433.32 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 1-[(R)-cyclopentyl-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.FC(F)C(F)(F)Oc1ccc([C@@H](C2CCCC2)N2CCNCC2)cc1 |
| InChI | InChI=1S/C18H24F4N2O.2ClH/c19-17(20)18(21,22)25-15-7-5-14(6-8-15)16(13-3-1-2-4-13)24-11-9-23-10-12-24;;/h5-8,13,16-17,23H,1-4,9-12H2;2*1H/t16-;;/m1../s1 |
| InChIKey | ZGEKNAWBYCYSGK-GGMCWBHBSA-N |
| XLogP | 4.90 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.32 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|