C18H27Cl2F3N2O — CID 171279205
1-[(S)-cyclohexyl-[4-(trifluoromethoxy)phenyl]methyl]piperazine;dihydrochloride (PubChem CID 171279205) has the molecular formula C18H27Cl2F3N2O and a molecular weight of 415.33 g/mol. Its IUPAC name is 1-[(S)-cyclohexyl-[4-(trifluoromethoxy)phenyl]methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(S)-cyclohexyl-[4-(trifluoromethoxy)phenyl]methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171279205 |
| Molecular Formula | C18H27Cl2F3N2O |
| Molecular Weight | 415.33 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | 1-[(S)-cyclohexyl-[4-(trifluoromethoxy)phenyl]methyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.FC(F)(F)Oc1ccc([C@H](C2CCCCC2)N2CCNCC2)cc1 |
| InChI | InChI=1S/C18H25F3N2O.2ClH/c19-18(20,21)24-16-8-6-15(7-9-16)17(14-4-2-1-3-5-14)23-12-10-22-11-13-23;;/h6-9,14,17,22H,1-5,10-13H2;2*1H/t17-;;/m0../s1 |
| InChIKey | KZGOZHAULQAWGQ-RMRYJAPISA-N |
| XLogP | 4.96 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.33 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |