C16H23ClF2N2O — CID 171176375
1-[(R)-cyclobutyl-[4-(difluoromethoxy)phenyl]methyl]piperazine;hydrochloride (PubChem CID 171176375) has the molecular formula C16H23ClF2N2O and a molecular weight of 332.82 g/mol. Its IUPAC name is 1-[(R)-cyclobutyl-[4-(difluoromethoxy)phenyl]methyl]piperazine;hydrochloride.
| Compound Name | 1-[(R)-cyclobutyl-[4-(difluoromethoxy)phenyl]methyl]piperazine;hydrochloride |
|---|---|
| PubChem CID | 171176375 |
| Molecular Formula | C16H23ClF2N2O |
| Molecular Weight | 332.82 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 1-[(R)-cyclobutyl-[4-(difluoromethoxy)phenyl]methyl]piperazine;hydrochloride |
| SMILES | Cl.FC(F)Oc1ccc([C@@H](C2CCC2)N2CCNCC2)cc1 |
| InChI | InChI=1S/C16H22F2N2O.ClH/c17-16(18)21-14-6-4-13(5-7-14)15(12-2-1-3-12)20-10-8-19-9-11-20;/h4-7,12,15-16,19H,1-3,8-11H2;1H/t15-;/m1./s1 |
| InChIKey | LZIMXPIJGWPLIU-XFULWGLBSA-N |
| XLogP | 3.46 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.82 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |