C17H26Cl2F2N2O2 — CID 171290879
1-[(R)-[4-(difluoromethoxy)phenyl]-(oxan-4-yl)methyl]piperazine;dihydrochloride (PubChem CID 171290879) has the molecular formula C17H26Cl2F2N2O2 and a molecular weight of 399.31 g/mol. Its IUPAC name is 1-[(R)-[4-(difluoromethoxy)phenyl]-(oxan-4-yl)methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(R)-[4-(difluoromethoxy)phenyl]-(oxan-4-yl)methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171290879 |
| Molecular Formula | C17H26Cl2F2N2O2 |
| Molecular Weight | 399.31 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 1-[(R)-[4-(difluoromethoxy)phenyl]-(oxan-4-yl)methyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.FC(F)Oc1ccc([C@@H](C2CCOCC2)N2CCNCC2)cc1 |
| InChI | InChI=1S/C17H24F2N2O2.2ClH/c18-17(19)23-15-3-1-13(2-4-15)16(14-5-11-22-12-6-14)21-9-7-20-8-10-21;;/h1-4,14,16-17,20H,5-12H2;2*1H/t16-;;/m0../s1 |
| InChIKey | NLBKYQQLOQUBIH-SQKCAUCHSA-N |
| XLogP | 3.50 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.31 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |