C18H26Cl2F4N2O2 — CID 171279633
1-[(S)-oxan-4-yl-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]piperazine;dihydrochloride (PubChem CID 171279633) has the molecular formula C18H26Cl2F4N2O2 and a molecular weight of 449.32 g/mol. Its IUPAC name is 1-[(S)-oxan-4-yl-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(S)-oxan-4-yl-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171279633 |
| Molecular Formula | C18H26Cl2F4N2O2 |
| Molecular Weight | 449.32 g/mol |
| Exact Mass | 448.13 |
| IUPAC Name | 1-[(S)-oxan-4-yl-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]methyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.FC(F)C(F)(F)Oc1cccc([C@H](C2CCOCC2)N2CCNCC2)c1 |
| InChI | InChI=1S/C18H24F4N2O2.2ClH/c19-17(20)18(21,22)26-15-3-1-2-14(12-15)16(13-4-10-25-11-5-13)24-8-6-23-7-9-24;;/h1-3,12-13,16-17,23H,4-11H2;2*1H/t16-;;/m0../s1 |
| InChIKey | UTLYKJYGZRNIHT-SQKCAUCHSA-N |
| XLogP | 4.14 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.32 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|