C17H25Cl2N3O — CID 171287621
3-[(R)-oxan-4-yl(piperazin-1-yl)methyl]benzonitrile;dihydrochloride (PubChem CID 171287621) has the molecular formula C17H25Cl2N3O and a molecular weight of 358.31 g/mol. Its IUPAC name is 3-[(R)-oxan-4-yl(piperazin-1-yl)methyl]benzonitrile;dihydrochloride.
| Compound Name | 3-[(R)-oxan-4-yl(piperazin-1-yl)methyl]benzonitrile;dihydrochloride |
|---|---|
| PubChem CID | 171287621 |
| Molecular Formula | C17H25Cl2N3O |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 3-[(R)-oxan-4-yl(piperazin-1-yl)methyl]benzonitrile;dihydrochloride |
| SMILES | Cl.Cl.N#Cc1cccc([C@@H](C2CCOCC2)N2CCNCC2)c1 |
| InChI | InChI=1S/C17H23N3O.2ClH/c18-13-14-2-1-3-16(12-14)17(15-4-10-21-11-5-15)20-8-6-19-7-9-20;;/h1-3,12,15,17,19H,4-11H2;2*1H/t17-;;/m1../s1 |
| InChIKey | IJYBQGLFXQSDAR-ZEECNFPPSA-N |
| XLogP | 2.77 |
| TPSA | 48.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |