C17H23F3N2O — CID 171291306
1-[(R)-oxan-4-yl-[3-(trifluoromethyl)phenyl]methyl]piperazine (PubChem CID 171291306) has the molecular formula C17H23F3N2O and a molecular weight of 328.38 g/mol. Its IUPAC name is 1-[(R)-oxan-4-yl-[3-(trifluoromethyl)phenyl]methyl]piperazine.
| Compound Name | 1-[(R)-oxan-4-yl-[3-(trifluoromethyl)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 171291306 |
| Molecular Formula | C17H23F3N2O |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 1-[(R)-oxan-4-yl-[3-(trifluoromethyl)phenyl]methyl]piperazine |
| SMILES | FC(F)(F)c1cccc([C@@H](C2CCOCC2)N2CCNCC2)c1 |
| InChI | InChI=1S/C17H23F3N2O/c18-17(19,20)15-3-1-2-14(12-15)16(13-4-10-23-11-5-13)22-8-6-21-7-9-22/h1-3,12-13,16,21H,4-11H2/t16-/m1/s1 |
| InChIKey | AMAZEEVMSNCDGU-MRXNPFEDSA-N |
| XLogP | 3.08 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |