C16H21F3N2 — CID 68931957
(2R)-1-[cyclopropyl-[3-(trifluoromethyl)phenyl]methyl]-2-methylpiperazine (PubChem CID 68931957) has the molecular formula C16H21F3N2 and a molecular weight of 298.35 g/mol. Its IUPAC name is (2R)-1-[cyclopropyl-[3-(trifluoromethyl)phenyl]methyl]-2-methylpiperazine.
| Compound Name | (2R)-1-[cyclopropyl-[3-(trifluoromethyl)phenyl]methyl]-2-methylpiperazine |
|---|---|
| PubChem CID | 68931957 |
| Molecular Formula | C16H21F3N2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | (2R)-1-[cyclopropyl-[3-(trifluoromethyl)phenyl]methyl]-2-methylpiperazine |
| SMILES | C[C@@H]1CNCCN1C(c1cccc(C(F)(F)F)c1)C1CC1 |
| InChI | InChI=1S/C16H21F3N2/c1-11-10-20-7-8-21(11)15(12-5-6-12)13-3-2-4-14(9-13)16(17,18)19/h2-4,9,11-12,15,20H,5-8,10H2,1H3/t11-,15?/m1/s1 |
| InChIKey | HPHDUMAMMAJPNW-ZRKZCGFPSA-N |
| XLogP | 3.45 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |