C17H22ClF3N2O — CID 171296165
1-[(R)-[3-chloro-5-(trifluoromethyl)phenyl]-(oxan-4-yl)methyl]piperazine (PubChem CID 171296165) has the molecular formula C17H22ClF3N2O and a molecular weight of 362.82 g/mol. Its IUPAC name is 1-[(R)-[3-chloro-5-(trifluoromethyl)phenyl]-(oxan-4-yl)methyl]piperazine.
| Compound Name | 1-[(R)-[3-chloro-5-(trifluoromethyl)phenyl]-(oxan-4-yl)methyl]piperazine |
|---|---|
| PubChem CID | 171296165 |
| Molecular Formula | C17H22ClF3N2O |
| Molecular Weight | 362.82 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | 1-[(R)-[3-chloro-5-(trifluoromethyl)phenyl]-(oxan-4-yl)methyl]piperazine |
| SMILES | FC(F)(F)c1cc(Cl)cc([C@@H](C2CCOCC2)N2CCNCC2)c1 |
| InChI | InChI=1S/C17H22ClF3N2O/c18-15-10-13(9-14(11-15)17(19,20)21)16(12-1-7-24-8-2-12)23-5-3-22-4-6-23/h9-12,16,22H,1-8H2/t16-/m1/s1 |
| InChIKey | XLIOUHDFXZVYIY-MRXNPFEDSA-N |
| XLogP | 3.73 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.82 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |