C16H22BrFN2O — CID 171289452
1-[(R)-(3-bromo-5-fluorophenyl)-(oxan-4-yl)methyl]piperazine (PubChem CID 171289452) has the molecular formula C16H22BrFN2O and a molecular weight of 357.27 g/mol. Its IUPAC name is 1-[(R)-(3-bromo-5-fluorophenyl)-(oxan-4-yl)methyl]piperazine.
| Compound Name | 1-[(R)-(3-bromo-5-fluorophenyl)-(oxan-4-yl)methyl]piperazine |
|---|---|
| PubChem CID | 171289452 |
| Molecular Formula | C16H22BrFN2O |
| Molecular Weight | 357.27 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 1-[(R)-(3-bromo-5-fluorophenyl)-(oxan-4-yl)methyl]piperazine |
| SMILES | Fc1cc(Br)cc([C@@H](C2CCOCC2)N2CCNCC2)c1 |
| InChI | InChI=1S/C16H22BrFN2O/c17-14-9-13(10-15(18)11-14)16(12-1-7-21-8-2-12)20-5-3-19-4-6-20/h9-12,16,19H,1-8H2/t16-/m1/s1 |
| InChIKey | WFKMKJKKBKNYLL-MRXNPFEDSA-N |
| XLogP | 2.96 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.27 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |