C16H24BrCl2FN2 — CID 171289449
1-[(R)-(3-bromo-5-fluorophenyl)-cyclopentylmethyl]piperazine;dihydrochloride (PubChem CID 171289449) has the molecular formula C16H24BrCl2FN2 and a molecular weight of 414.19 g/mol. Its IUPAC name is 1-[(R)-(3-bromo-5-fluorophenyl)-cyclopentylmethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(R)-(3-bromo-5-fluorophenyl)-cyclopentylmethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171289449 |
| Molecular Formula | C16H24BrCl2FN2 |
| Molecular Weight | 414.19 g/mol |
| Exact Mass | 412.05 |
| IUPAC Name | 1-[(R)-(3-bromo-5-fluorophenyl)-cyclopentylmethyl]piperazine;dihydrochloride |
| SMILES | Cl.Cl.Fc1cc(Br)cc([C@@H](C2CCCC2)N2CCNCC2)c1 |
| InChI | InChI=1S/C16H22BrFN2.2ClH/c17-14-9-13(10-15(18)11-14)16(12-3-1-2-4-12)20-7-5-19-6-8-20;;/h9-12,16,19H,1-8H2;2*1H/t16-;;/m1../s1 |
| InChIKey | TTWJGYUDLXYZSX-GGMCWBHBSA-N |
| XLogP | 4.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.19 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |