C17H23BrF2N2 — CID 171165147
1-[(S)-(4-bromo-2,6-difluorophenyl)-cyclohexylmethyl]piperazine (PubChem CID 171165147) has the molecular formula C17H23BrF2N2 and a molecular weight of 373.29 g/mol. Its IUPAC name is 1-[(S)-(4-bromo-2,6-difluorophenyl)-cyclohexylmethyl]piperazine.
| Compound Name | 1-[(S)-(4-bromo-2,6-difluorophenyl)-cyclohexylmethyl]piperazine |
|---|---|
| PubChem CID | 171165147 |
| Molecular Formula | C17H23BrF2N2 |
| Molecular Weight | 373.29 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | 1-[(S)-(4-bromo-2,6-difluorophenyl)-cyclohexylmethyl]piperazine |
| SMILES | Fc1cc(Br)cc(F)c1[C@H](C1CCCCC1)N1CCNCC1 |
| InChI | InChI=1S/C17H23BrF2N2/c18-13-10-14(19)16(15(20)11-13)17(12-4-2-1-3-5-12)22-8-6-21-7-9-22/h10-12,17,21H,1-9H2/t17-/m0/s1 |
| InChIKey | KEPCVJUXCIRMPD-KRWDZBQOSA-N |
| XLogP | 4.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.29 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |