C16H25Br2Cl2N3O — CID 171286163
2,4-dibromo-6-[(R)-oxan-4-yl(piperazin-1-yl)methyl]aniline;dihydrochloride (PubChem CID 171286163) has the molecular formula C16H25Br2Cl2N3O and a molecular weight of 506.11 g/mol. Its IUPAC name is 2,4-dibromo-6-[(R)-oxan-4-yl(piperazin-1-yl)methyl]aniline;dihydrochloride.
| Compound Name | 2,4-dibromo-6-[(R)-oxan-4-yl(piperazin-1-yl)methyl]aniline;dihydrochloride |
|---|---|
| PubChem CID | 171286163 |
| Molecular Formula | C16H25Br2Cl2N3O |
| Molecular Weight | 506.11 g/mol |
| Exact Mass | 502.97 |
| IUPAC Name | 2,4-dibromo-6-[(R)-oxan-4-yl(piperazin-1-yl)methyl]aniline;dihydrochloride |
| SMILES | Cl.Cl.Nc1c(Br)cc(Br)cc1[C@@H](C1CCOCC1)N1CCNCC1 |
| InChI | InChI=1S/C16H23Br2N3O.2ClH/c17-12-9-13(15(19)14(18)10-12)16(11-1-7-22-8-2-11)21-5-3-20-4-6-21;;/h9-11,16,20H,1-8,19H2;2*1H/t16-;;/m1../s1 |
| InChIKey | FLVONSNMXGUWJD-GGMCWBHBSA-N |
| XLogP | 4.01 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.11 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|