C17H25BrN2O — CID 171288124
1-[(R)-(2-bromo-4-methylphenyl)-(oxan-4-yl)methyl]piperazine (PubChem CID 171288124) has the molecular formula C17H25BrN2O and a molecular weight of 353.30 g/mol. Its IUPAC name is 1-[(R)-(2-bromo-4-methylphenyl)-(oxan-4-yl)methyl]piperazine.
| Compound Name | 1-[(R)-(2-bromo-4-methylphenyl)-(oxan-4-yl)methyl]piperazine |
|---|---|
| PubChem CID | 171288124 |
| Molecular Formula | C17H25BrN2O |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 1-[(R)-(2-bromo-4-methylphenyl)-(oxan-4-yl)methyl]piperazine |
| SMILES | Cc1ccc([C@@H](C2CCOCC2)N2CCNCC2)c(Br)c1 |
| InChI | InChI=1S/C17H25BrN2O/c1-13-2-3-15(16(18)12-13)17(14-4-10-21-11-5-14)20-8-6-19-7-9-20/h2-3,12,14,17,19H,4-11H2,1H3/t17-/m1/s1 |
| InChIKey | YWIFQQCYVNPJNS-QGZVFWFLSA-N |
| XLogP | 3.13 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |