C17H25BrN2O3 — CID 171301218
2-bromo-4-methoxy-6-[(R)-oxan-4-yl(piperazin-1-yl)methyl]phenol (PubChem CID 171301218) has the molecular formula C17H25BrN2O3 and a molecular weight of 385.30 g/mol. Its IUPAC name is 2-bromo-4-methoxy-6-[(R)-oxan-4-yl(piperazin-1-yl)methyl]phenol.
| Compound Name | 2-bromo-4-methoxy-6-[(R)-oxan-4-yl(piperazin-1-yl)methyl]phenol |
|---|---|
| PubChem CID | 171301218 |
| Molecular Formula | C17H25BrN2O3 |
| Molecular Weight | 385.30 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 2-bromo-4-methoxy-6-[(R)-oxan-4-yl(piperazin-1-yl)methyl]phenol |
| SMILES | COc1cc(Br)c(O)c([C@@H](C2CCOCC2)N2CCNCC2)c1 |
| InChI | InChI=1S/C17H25BrN2O3/c1-22-13-10-14(17(21)15(18)11-13)16(12-2-8-23-9-3-12)20-6-4-19-5-7-20/h10-12,16,19,21H,2-9H2,1H3/t16-/m1/s1 |
| InChIKey | BPHDLLZBMLXXPV-MRXNPFEDSA-N |
| XLogP | 2.54 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.30 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|