C17H27BrCl2N2O2 — CID 171290128
1-[(R)-(2-bromo-5-methoxyphenyl)-(oxan-4-yl)methyl]piperazine;dihydrochloride (PubChem CID 171290128) has the molecular formula C17H27BrCl2N2O2 and a molecular weight of 442.23 g/mol. Its IUPAC name is 1-[(R)-(2-bromo-5-methoxyphenyl)-(oxan-4-yl)methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(R)-(2-bromo-5-methoxyphenyl)-(oxan-4-yl)methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171290128 |
| Molecular Formula | C17H27BrCl2N2O2 |
| Molecular Weight | 442.23 g/mol |
| Exact Mass | 440.06 |
| IUPAC Name | 1-[(R)-(2-bromo-5-methoxyphenyl)-(oxan-4-yl)methyl]piperazine;dihydrochloride |
| SMILES | COc1ccc(Br)c([C@@H](C2CCOCC2)N2CCNCC2)c1.Cl.Cl |
| InChI | InChI=1S/C17H25BrN2O2.2ClH/c1-21-14-2-3-16(18)15(12-14)17(13-4-10-22-11-5-13)20-8-6-19-7-9-20;;/h2-3,12-13,17,19H,4-11H2,1H3;2*1H/t17-;;/m1../s1 |
| InChIKey | VYVSKJJWPXQDBM-ZEECNFPPSA-N |
| XLogP | 3.67 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.23 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |