C13H21BrCl2N2O — CID 171290106
1-[(1R)-1-(2-bromo-5-methoxyphenyl)ethyl]piperazine;dihydrochloride (PubChem CID 171290106) has the molecular formula C13H21BrCl2N2O and a molecular weight of 372.13 g/mol. Its IUPAC name is 1-[(1R)-1-(2-bromo-5-methoxyphenyl)ethyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1R)-1-(2-bromo-5-methoxyphenyl)ethyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171290106 |
| Molecular Formula | C13H21BrCl2N2O |
| Molecular Weight | 372.13 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | 1-[(1R)-1-(2-bromo-5-methoxyphenyl)ethyl]piperazine;dihydrochloride |
| SMILES | COc1ccc(Br)c([C@@H](C)N2CCNCC2)c1.Cl.Cl |
| InChI | InChI=1S/C13H19BrN2O.2ClH/c1-10(16-7-5-15-6-8-16)12-9-11(17-2)3-4-13(12)14;;/h3-4,9-10,15H,5-8H2,1-2H3;2*1H/t10-;;/m1../s1 |
| InChIKey | ZNEGNYYLTAZHOY-YQFADDPSSA-N |
| XLogP | 3.27 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.13 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |