C16H27BrCl2N2O — CID 171305297
1-[(1S)-1-(2-bromo-5-methoxyphenyl)-2-methylbutyl]piperazine;dihydrochloride (PubChem CID 171305297) has the molecular formula C16H27BrCl2N2O and a molecular weight of 414.22 g/mol. Its IUPAC name is 1-[(1S)-1-(2-bromo-5-methoxyphenyl)-2-methylbutyl]piperazine;dihydrochloride.
| Compound Name | 1-[(1S)-1-(2-bromo-5-methoxyphenyl)-2-methylbutyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171305297 |
| Molecular Formula | C16H27BrCl2N2O |
| Molecular Weight | 414.22 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | 1-[(1S)-1-(2-bromo-5-methoxyphenyl)-2-methylbutyl]piperazine;dihydrochloride |
| SMILES | CCC(C)[C@@H](c1cc(OC)ccc1Br)N1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C16H25BrN2O.2ClH/c1-4-12(2)16(19-9-7-18-8-10-19)14-11-13(20-3)5-6-15(14)17;;/h5-6,11-12,16,18H,4,7-10H2,1-3H3;2*1H/t12?,16-;;/m0../s1 |
| InChIKey | VIBITKAFCGIGEK-JKQXYDNJSA-N |
| XLogP | 4.29 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.22 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |