C14H20BrCl2N3O — CID 171306796
(3R)-3-(2-bromo-5-methoxyphenyl)-3-piperazin-1-ylpropanenitrile;dihydrochloride (PubChem CID 171306796) has the molecular formula C14H20BrCl2N3O and a molecular weight of 397.14 g/mol. Its IUPAC name is (3R)-3-(2-bromo-5-methoxyphenyl)-3-piperazin-1-ylpropanenitrile;dihydrochloride.
| Compound Name | (3R)-3-(2-bromo-5-methoxyphenyl)-3-piperazin-1-ylpropanenitrile;dihydrochloride |
|---|---|
| PubChem CID | 171306796 |
| Molecular Formula | C14H20BrCl2N3O |
| Molecular Weight | 397.14 g/mol |
| Exact Mass | 395.02 |
| IUPAC Name | (3R)-3-(2-bromo-5-methoxyphenyl)-3-piperazin-1-ylpropanenitrile;dihydrochloride |
| SMILES | COc1ccc(Br)c([C@@H](CC#N)N2CCNCC2)c1.Cl.Cl |
| InChI | InChI=1S/C14H18BrN3O.2ClH/c1-19-11-2-3-13(15)12(10-11)14(4-5-16)18-8-6-17-7-9-18;;/h2-3,10,14,17H,4,6-9H2,1H3;2*1H/t14-;;/m1../s1 |
| InChIKey | PLIOMEXOCGBASA-FMOMHUKBSA-N |
| XLogP | 3.16 |
| TPSA | 48.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.14 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |