C18H30Cl2N2O3 — CID 171274767
1-[(S)-(2,4-dimethoxyphenyl)-(oxan-4-yl)methyl]piperazine;dihydrochloride (PubChem CID 171274767) has the molecular formula C18H30Cl2N2O3 and a molecular weight of 393.36 g/mol. Its IUPAC name is 1-[(S)-(2,4-dimethoxyphenyl)-(oxan-4-yl)methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(S)-(2,4-dimethoxyphenyl)-(oxan-4-yl)methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171274767 |
| Molecular Formula | C18H30Cl2N2O3 |
| Molecular Weight | 393.36 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 1-[(S)-(2,4-dimethoxyphenyl)-(oxan-4-yl)methyl]piperazine;dihydrochloride |
| SMILES | COc1ccc([C@H](C2CCOCC2)N2CCNCC2)c(OC)c1.Cl.Cl |
| InChI | InChI=1S/C18H28N2O3.2ClH/c1-21-15-3-4-16(17(13-15)22-2)18(14-5-11-23-12-6-14)20-9-7-19-8-10-20;;/h3-4,13-14,18-19H,5-12H2,1-2H3;2*1H/t18-;;/m0../s1 |
| InChIKey | NWLDKZUPGIBECU-NTEVMMBTSA-N |
| XLogP | 2.92 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |