C16H26Cl2N2O — CID 171295234
1-[(R)-cyclopropyl-(4-methoxy-2-methylphenyl)methyl]piperazine;dihydrochloride (PubChem CID 171295234) has the molecular formula C16H26Cl2N2O and a molecular weight of 333.30 g/mol. Its IUPAC name is 1-[(R)-cyclopropyl-(4-methoxy-2-methylphenyl)methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(R)-cyclopropyl-(4-methoxy-2-methylphenyl)methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171295234 |
| Molecular Formula | C16H26Cl2N2O |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | 1-[(R)-cyclopropyl-(4-methoxy-2-methylphenyl)methyl]piperazine;dihydrochloride |
| SMILES | COc1ccc([C@@H](C2CC2)N2CCNCC2)c(C)c1.Cl.Cl |
| InChI | InChI=1S/C16H24N2O.2ClH/c1-12-11-14(19-2)5-6-15(12)16(13-3-4-13)18-9-7-17-8-10-18;;/h5-6,11,13,16-17H,3-4,7-10H2,1-2H3;2*1H/t16-;;/m1../s1 |
| InChIKey | PCOJYUBATREGFX-GGMCWBHBSA-N |
| XLogP | 3.20 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |