C17H28Cl2N2O — CID 171282616
1-[(S)-cyclobutyl-(4-methoxy-2-methylphenyl)methyl]piperazine;dihydrochloride (PubChem CID 171282616) has the molecular formula C17H28Cl2N2O and a molecular weight of 347.33 g/mol. Its IUPAC name is 1-[(S)-cyclobutyl-(4-methoxy-2-methylphenyl)methyl]piperazine;dihydrochloride.
| Compound Name | 1-[(S)-cyclobutyl-(4-methoxy-2-methylphenyl)methyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 171282616 |
| Molecular Formula | C17H28Cl2N2O |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 1-[(S)-cyclobutyl-(4-methoxy-2-methylphenyl)methyl]piperazine;dihydrochloride |
| SMILES | COc1ccc([C@H](C2CCC2)N2CCNCC2)c(C)c1.Cl.Cl |
| InChI | InChI=1S/C17H26N2O.2ClH/c1-13-12-15(20-2)6-7-16(13)17(14-4-3-5-14)19-10-8-18-9-11-19;;/h6-7,12,14,17-18H,3-5,8-11H2,1-2H3;2*1H/t17-;;/m0../s1 |
| InChIKey | JGDDAAYPOJBEME-RMRYJAPISA-N |
| XLogP | 3.59 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |