C18H28N2O4 — CID 171278919
3,5-dimethoxy-2-[(S)-oxan-4-yl(piperazin-1-yl)methyl]phenol (PubChem CID 171278919) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is 3,5-dimethoxy-2-[(S)-oxan-4-yl(piperazin-1-yl)methyl]phenol.
| Compound Name | 3,5-dimethoxy-2-[(S)-oxan-4-yl(piperazin-1-yl)methyl]phenol |
|---|---|
| PubChem CID | 171278919 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | 3,5-dimethoxy-2-[(S)-oxan-4-yl(piperazin-1-yl)methyl]phenol |
| SMILES | COc1cc(O)c([C@H](C2CCOCC2)N2CCNCC2)c(OC)c1 |
| InChI | InChI=1S/C18H28N2O4/c1-22-14-11-15(21)17(16(12-14)23-2)18(13-3-9-24-10-4-13)20-7-5-19-6-8-20/h11-13,18-19,21H,3-10H2,1-2H3/t18-/m0/s1 |
| InChIKey | ZVHRBEZFGFJVDX-SFHVURJKSA-N |
| XLogP | 1.78 |
| TPSA | 63.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|