C16H26Cl2N2O3 — CID 171291535
2-[(R)-cyclopropyl(piperazin-1-yl)methyl]-3,5-dimethoxyphenol;dihydrochloride (PubChem CID 171291535) has the molecular formula C16H26Cl2N2O3 and a molecular weight of 365.30 g/mol. Its IUPAC name is 2-[(R)-cyclopropyl(piperazin-1-yl)methyl]-3,5-dimethoxyphenol;dihydrochloride.
| Compound Name | 2-[(R)-cyclopropyl(piperazin-1-yl)methyl]-3,5-dimethoxyphenol;dihydrochloride |
|---|---|
| PubChem CID | 171291535 |
| Molecular Formula | C16H26Cl2N2O3 |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 2-[(R)-cyclopropyl(piperazin-1-yl)methyl]-3,5-dimethoxyphenol;dihydrochloride |
| SMILES | COc1cc(O)c([C@@H](C2CC2)N2CCNCC2)c(OC)c1.Cl.Cl |
| InChI | InChI=1S/C16H24N2O3.2ClH/c1-20-12-9-13(19)15(14(10-12)21-2)16(11-3-4-11)18-7-5-17-6-8-18;;/h9-11,16-17,19H,3-8H2,1-2H3;2*1H/t16-;;/m1../s1 |
| InChIKey | DGFWZCIFWVZNLI-GGMCWBHBSA-N |
| XLogP | 2.61 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|