C14H22N2O3 — CID 171314427
2-[(R)-amino(piperidin-4-yl)methyl]-3,5-dimethoxyphenol (PubChem CID 171314427) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-[(R)-amino(piperidin-4-yl)methyl]-3,5-dimethoxyphenol.
| Compound Name | 2-[(R)-amino(piperidin-4-yl)methyl]-3,5-dimethoxyphenol |
|---|---|
| PubChem CID | 171314427 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 2-[(R)-amino(piperidin-4-yl)methyl]-3,5-dimethoxyphenol |
| SMILES | COc1cc(O)c([C@H](N)C2CCNCC2)c(OC)c1 |
| InChI | InChI=1S/C14H22N2O3/c1-18-10-7-11(17)13(12(8-10)19-2)14(15)9-3-5-16-6-4-9/h7-9,14,16-17H,3-6,15H2,1-2H3/t14-/m1/s1 |
| InChIKey | JGDCUYRRCMEILY-CQSZACIVSA-N |
| XLogP | 1.41 |
| TPSA | 76.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|