C10H14FNO3 — CID 171226643
2-[(1R)-1-amino-2-fluoroethyl]-3,5-dimethoxyphenol (PubChem CID 171226643) has the molecular formula C10H14FNO3 and a molecular weight of 215.22 g/mol. Its IUPAC name is 2-[(1R)-1-amino-2-fluoroethyl]-3,5-dimethoxyphenol.
| Compound Name | 2-[(1R)-1-amino-2-fluoroethyl]-3,5-dimethoxyphenol |
|---|---|
| PubChem CID | 171226643 |
| Molecular Formula | C10H14FNO3 |
| Molecular Weight | 215.22 g/mol |
| Exact Mass | 215.10 |
| IUPAC Name | 2-[(1R)-1-amino-2-fluoroethyl]-3,5-dimethoxyphenol |
| SMILES | COc1cc(O)c([C@@H](N)CF)c(OC)c1 |
| InChI | InChI=1S/C10H14FNO3/c1-14-6-3-8(13)10(7(12)5-11)9(4-6)15-2/h3-4,7,13H,5,12H2,1-2H3/t7-/m0/s1 |
| InChIKey | OOQJPAXNKNDHDF-ZETCQYMHSA-N |
| XLogP | 1.38 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.22 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|