C11H17ClFNO3 — CID 171207100
2-[(1R)-1-amino-3-fluoropropyl]-3,5-dimethoxyphenol;hydrochloride (PubChem CID 171207100) has the molecular formula C11H17ClFNO3 and a molecular weight of 265.71 g/mol. Its IUPAC name is 2-[(1R)-1-amino-3-fluoropropyl]-3,5-dimethoxyphenol;hydrochloride.
| Compound Name | 2-[(1R)-1-amino-3-fluoropropyl]-3,5-dimethoxyphenol;hydrochloride |
|---|---|
| PubChem CID | 171207100 |
| Molecular Formula | C11H17ClFNO3 |
| Molecular Weight | 265.71 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 2-[(1R)-1-amino-3-fluoropropyl]-3,5-dimethoxyphenol;hydrochloride |
| SMILES | COc1cc(O)c([C@H](N)CCF)c(OC)c1.Cl |
| InChI | InChI=1S/C11H16FNO3.ClH/c1-15-7-5-9(14)11(8(13)3-4-12)10(6-7)16-2;/h5-6,8,14H,3-4,13H2,1-2H3;1H/t8-;/m1./s1 |
| InChIKey | BQIPSZQQVLRVAI-DDWIOCJRSA-N |
| XLogP | 2.19 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.71 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|