C12H21ClN2O3 — CID 171201026
(1R)-1-(2,4,6-trimethoxyphenyl)propane-1,3-diamine;hydrochloride (PubChem CID 171201026) has the molecular formula C12H21ClN2O3 and a molecular weight of 276.76 g/mol. Its IUPAC name is (1R)-1-(2,4,6-trimethoxyphenyl)propane-1,3-diamine;hydrochloride.
| Compound Name | (1R)-1-(2,4,6-trimethoxyphenyl)propane-1,3-diamine;hydrochloride |
|---|---|
| PubChem CID | 171201026 |
| Molecular Formula | C12H21ClN2O3 |
| Molecular Weight | 276.76 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | (1R)-1-(2,4,6-trimethoxyphenyl)propane-1,3-diamine;hydrochloride |
| SMILES | COc1cc(OC)c([C@H](N)CCN)c(OC)c1.Cl |
| InChI | InChI=1S/C12H20N2O3.ClH/c1-15-8-6-10(16-2)12(9(14)4-5-13)11(7-8)17-3;/h6-7,9H,4-5,13-14H2,1-3H3;1H/t9-;/m1./s1 |
| InChIKey | AKNMSXQTAWPERF-SBSPUUFOSA-N |
| XLogP | 1.48 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.76 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |