(4R)-4-amino-4-(2,4,6-trimethoxyphenyl)butanoic acid

C13H19NO5 — CID 28744321

IUPAC(4R)-4-amino-4-(2,4,6-trimethoxyphenyl)butanoic acid
SMILESCOc1cc(OC)c([C@H](N)CCC(=O)O)c(OC)c1
InChIInChI=1S/C13H19NO5/c1-17-8-6-10(18-2)13(11(7-8)19-3)9(14)4-5-12(15)16/h6-7,9H,4-5,14H2,1-3H3,(H,15,16)/t9-/m1/s1
InChIKeyCLEJGDKHMVUAIX-SECBINFHSA-N
MW269.30 g/mol
LogP1.58
Rot. Bonds7

About (4R)-4-amino-4-(2,4,6-trimethoxyphenyl)butanoic acid

(4R)-4-amino-4-(2,4,6-trimethoxyphenyl)butanoic acid (PubChem CID 28744321) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is (4R)-4-amino-4-(2,4,6-trimethoxyphenyl)butanoic acid.

Molecular Properties

Compound Name(4R)-4-amino-4-(2,4,6-trimethoxyphenyl)butanoic acid
PubChem CID28744321
Molecular FormulaC13H19NO5
Molecular Weight269.30 g/mol
Exact Mass269.13
IUPAC Name(4R)-4-amino-4-(2,4,6-trimethoxyphenyl)butanoic acid
SMILESCOc1cc(OC)c([C@H](N)CCC(=O)O)c(OC)c1
InChIInChI=1S/C13H19NO5/c1-17-8-6-10(18-2)13(11(7-8)19-3)9(14)4-5-12(15)16/h6-7,9H,4-5,14H2,1-3H3,(H,15,16)/t9-/m1/s1
InChIKeyCLEJGDKHMVUAIX-SECBINFHSA-N
XLogP1.58
TPSA91.01 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds7
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500269.30
LogP ≤ 51.58
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze (4R)-4-amino-4-(2,4,6-trimethoxyphenyl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4R)-4-amino-4-(2,4,6-trimethoxyphenyl)butanoic acid?
The IUPAC name of (4R)-4-amino-4-(2,4,6-trimethoxyphenyl)butanoic acid (CID 28744321) is (4R)-4-amino-4-(2,4,6-trimethoxyphenyl)butanoic acid.
What is the SMILES notation for (4R)-4-amino-4-(2,4,6-trimethoxyphenyl)butanoic acid?
The canonical SMILES for (4R)-4-amino-4-(2,4,6-trimethoxyphenyl)butanoic acid is COc1cc(OC)c([C@H](N)CCC(=O)O)c(OC)c1.
What is the InChIKey of (4R)-4-amino-4-(2,4,6-trimethoxyphenyl)butanoic acid?
The InChIKey is CLEJGDKHMVUAIX-SECBINFHSA-N. The full InChI is InChI=1S/C13H19NO5/c1-17-8-6-10(18-2)13(11(7-8)19-3)9(14)4-5-12(15)16/h6-7,9H,4-5,14H2,1-3H3,(H,15,16)/t9-/m1/s1.
What are the key properties of (4R)-4-amino-4-(2,4,6-trimethoxyphenyl)butanoic acid?
(4R)-4-amino-4-(2,4,6-trimethoxyphenyl)butanoic acid has a molecular weight of 269.30 g/mol, XLogP of 1.58, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-amino-4-(2,4,6-trimethoxyphenyl)butanoic acid is sourced from PubChem (CID 28744321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).