C13H19NO5 — CID 28744321
(4R)-4-amino-4-(2,4,6-trimethoxyphenyl)butanoic acid (PubChem CID 28744321) has the molecular formula C13H19NO5 and a molecular weight of 269.30 g/mol. Its IUPAC name is (4R)-4-amino-4-(2,4,6-trimethoxyphenyl)butanoic acid.
| Compound Name | (4R)-4-amino-4-(2,4,6-trimethoxyphenyl)butanoic acid |
|---|---|
| PubChem CID | 28744321 |
| Molecular Formula | C13H19NO5 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | (4R)-4-amino-4-(2,4,6-trimethoxyphenyl)butanoic acid |
| SMILES | COc1cc(OC)c([C@H](N)CCC(=O)O)c(OC)c1 |
| InChI | InChI=1S/C13H19NO5/c1-17-8-6-10(18-2)13(11(7-8)19-3)9(14)4-5-12(15)16/h6-7,9H,4-5,14H2,1-3H3,(H,15,16)/t9-/m1/s1 |
| InChIKey | CLEJGDKHMVUAIX-SECBINFHSA-N |
| XLogP | 1.58 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |