C14H24ClNO3 — CID 171201038
(1R)-1-(2,4,6-trimethoxyphenyl)pentan-1-amine;hydrochloride (PubChem CID 171201038) has the molecular formula C14H24ClNO3 and a molecular weight of 289.80 g/mol. Its IUPAC name is (1R)-1-(2,4,6-trimethoxyphenyl)pentan-1-amine;hydrochloride.
| Compound Name | (1R)-1-(2,4,6-trimethoxyphenyl)pentan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171201038 |
| Molecular Formula | C14H24ClNO3 |
| Molecular Weight | 289.80 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | (1R)-1-(2,4,6-trimethoxyphenyl)pentan-1-amine;hydrochloride |
| SMILES | CCCC[C@@H](N)c1c(OC)cc(OC)cc1OC.Cl |
| InChI | InChI=1S/C14H23NO3.ClH/c1-5-6-7-11(15)14-12(17-3)8-10(16-2)9-13(14)18-4;/h8-9,11H,5-7,15H2,1-4H3;1H/t11-;/m1./s1 |
| InChIKey | QKPMIRSMSKWSGU-RFVHGSKJSA-N |
| XLogP | 3.32 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.80 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |