C13H22ClNO2 — CID 171219764
(1S)-1-(2,5-dimethoxyphenyl)pentan-1-amine;hydrochloride (PubChem CID 171219764) has the molecular formula C13H22ClNO2 and a molecular weight of 259.78 g/mol. Its IUPAC name is (1S)-1-(2,5-dimethoxyphenyl)pentan-1-amine;hydrochloride.
| Compound Name | (1S)-1-(2,5-dimethoxyphenyl)pentan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171219764 |
| Molecular Formula | C13H22ClNO2 |
| Molecular Weight | 259.78 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | (1S)-1-(2,5-dimethoxyphenyl)pentan-1-amine;hydrochloride |
| SMILES | CCCC[C@H](N)c1cc(OC)ccc1OC.Cl |
| InChI | InChI=1S/C13H21NO2.ClH/c1-4-5-6-12(14)11-9-10(15-2)7-8-13(11)16-3;/h7-9,12H,4-6,14H2,1-3H3;1H/t12-;/m0./s1 |
| InChIKey | XKOIMWLHTVXYES-YDALLXLXSA-N |
| XLogP | 3.32 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.78 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |