C13H19ClO2 — CID 61084308
2-(1-chloropentyl)-1,4-dimethoxybenzene (PubChem CID 61084308) has the molecular formula C13H19ClO2 and a molecular weight of 242.75 g/mol. Its IUPAC name is 2-(1-chloropentyl)-1,4-dimethoxybenzene.
| Compound Name | 2-(1-chloropentyl)-1,4-dimethoxybenzene |
|---|---|
| PubChem CID | 61084308 |
| Molecular Formula | C13H19ClO2 |
| Molecular Weight | 242.75 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 2-(1-chloropentyl)-1,4-dimethoxybenzene |
| SMILES | CCCCC(Cl)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C13H19ClO2/c1-4-5-6-12(14)11-9-10(15-2)7-8-13(11)16-3/h7-9,12H,4-6H2,1-3H3 |
| InChIKey | JOXWQBFQPUNONE-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.75 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|