C9H10Cl2O2 — CID 23431965
2-(dichloromethyl)-1,4-dimethoxybenzene (PubChem CID 23431965) has the molecular formula C9H10Cl2O2 and a molecular weight of 221.08 g/mol. Its IUPAC name is 2-(dichloromethyl)-1,4-dimethoxybenzene.
| Compound Name | 2-(dichloromethyl)-1,4-dimethoxybenzene |
|---|---|
| PubChem CID | 23431965 |
| Molecular Formula | C9H10Cl2O2 |
| Molecular Weight | 221.08 g/mol |
| Exact Mass | 220.01 |
| IUPAC Name | 2-(dichloromethyl)-1,4-dimethoxybenzene |
| SMILES | COc1ccc(OC)c(C(Cl)Cl)c1 |
| InChI | InChI=1S/C9H10Cl2O2/c1-12-6-3-4-8(13-2)7(5-6)9(10)11/h3-5,9H,1-2H3 |
| InChIKey | PTWMJIAIGSFGPD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.08 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|