C10H12Cl2O3 — CID 164893079
2,2-dichloro-1-(2,5-dimethoxyphenyl)ethanol (PubChem CID 164893079) has the molecular formula C10H12Cl2O3 and a molecular weight of 251.11 g/mol. Its IUPAC name is 2,2-dichloro-1-(2,5-dimethoxyphenyl)ethanol.
| Compound Name | 2,2-dichloro-1-(2,5-dimethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 164893079 |
| Molecular Formula | C10H12Cl2O3 |
| Molecular Weight | 251.11 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | 2,2-dichloro-1-(2,5-dimethoxyphenyl)ethanol |
| SMILES | COc1ccc(OC)c(C(O)C(Cl)Cl)c1 |
| InChI | InChI=1S/C10H12Cl2O3/c1-14-6-3-4-8(15-2)7(5-6)9(13)10(11)12/h3-5,9-10,13H,1-2H3 |
| InChIKey | DJGSNSGFFKZZMS-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.11 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|