C9H9BrCl2O2 — CID 164892127
1-(5-bromo-2-methoxyphenyl)-2,2-dichloroethanol (PubChem CID 164892127) has the molecular formula C9H9BrCl2O2 and a molecular weight of 299.98 g/mol. Its IUPAC name is 1-(5-bromo-2-methoxyphenyl)-2,2-dichloroethanol.
| Compound Name | 1-(5-bromo-2-methoxyphenyl)-2,2-dichloroethanol |
|---|---|
| PubChem CID | 164892127 |
| Molecular Formula | C9H9BrCl2O2 |
| Molecular Weight | 299.98 g/mol |
| Exact Mass | 297.92 |
| IUPAC Name | 1-(5-bromo-2-methoxyphenyl)-2,2-dichloroethanol |
| SMILES | COc1ccc(Br)cc1C(O)C(Cl)Cl |
| InChI | InChI=1S/C9H9BrCl2O2/c1-14-7-3-2-5(10)4-6(7)8(13)9(11)12/h2-4,8-9,13H,1H3 |
| InChIKey | WRJOGOMMNMIPAK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.98 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|