C8H6Br2Cl2O — CID 163445311
2,2-dichloro-1-(2,5-dibromophenyl)ethanol (PubChem CID 163445311) has the molecular formula C8H6Br2Cl2O and a molecular weight of 348.85 g/mol. Its IUPAC name is 2,2-dichloro-1-(2,5-dibromophenyl)ethanol.
| Compound Name | 2,2-dichloro-1-(2,5-dibromophenyl)ethanol |
|---|---|
| PubChem CID | 163445311 |
| Molecular Formula | C8H6Br2Cl2O |
| Molecular Weight | 348.85 g/mol |
| Exact Mass | 345.82 |
| IUPAC Name | 2,2-dichloro-1-(2,5-dibromophenyl)ethanol |
| SMILES | OC(c1cc(Br)ccc1Br)C(Cl)Cl |
| InChI | InChI=1S/C8H6Br2Cl2O/c9-4-1-2-6(10)5(3-4)7(13)8(11)12/h1-3,7-8,13H |
| InChIKey | BBZXMBJIMPSZIU-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.85 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|