C11H7Br3O2 — CID 61099040
(5-bromofuran-2-yl)-(2,5-dibromophenyl)methanol (PubChem CID 61099040) has the molecular formula C11H7Br3O2 and a molecular weight of 410.89 g/mol. Its IUPAC name is (5-bromofuran-2-yl)-(2,5-dibromophenyl)methanol.
| Compound Name | (5-bromofuran-2-yl)-(2,5-dibromophenyl)methanol |
|---|---|
| PubChem CID | 61099040 |
| Molecular Formula | C11H7Br3O2 |
| Molecular Weight | 410.89 g/mol |
| Exact Mass | 407.80 |
| IUPAC Name | (5-bromofuran-2-yl)-(2,5-dibromophenyl)methanol |
| SMILES | OC(c1ccc(Br)o1)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C11H7Br3O2/c12-6-1-2-8(13)7(5-6)11(15)9-3-4-10(14)16-9/h1-5,11,15H |
| InChIKey | NKXSIWADDCDFLB-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.89 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |