C13H8Br2Cl2O — CID 63426086
(2,5-dibromophenyl)-(3,4-dichlorophenyl)methanol (PubChem CID 63426086) has the molecular formula C13H8Br2Cl2O and a molecular weight of 410.92 g/mol. Its IUPAC name is (2,5-dibromophenyl)-(3,4-dichlorophenyl)methanol.
| Compound Name | (2,5-dibromophenyl)-(3,4-dichlorophenyl)methanol |
|---|---|
| PubChem CID | 63426086 |
| Molecular Formula | C13H8Br2Cl2O |
| Molecular Weight | 410.92 g/mol |
| Exact Mass | 407.83 |
| IUPAC Name | (2,5-dibromophenyl)-(3,4-dichlorophenyl)methanol |
| SMILES | OC(c1ccc(Cl)c(Cl)c1)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C13H8Br2Cl2O/c14-8-2-3-10(15)9(6-8)13(18)7-1-4-11(16)12(17)5-7/h1-6,13,18H |
| InChIKey | SCUYGQNTIHNMKF-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.92 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |