C11H7Cl3O2 — CID 106688862
(5-chlorofuran-2-yl)-(3,4-dichlorophenyl)methanol (PubChem CID 106688862) has the molecular formula C11H7Cl3O2 and a molecular weight of 277.53 g/mol. Its IUPAC name is (5-chlorofuran-2-yl)-(3,4-dichlorophenyl)methanol.
| Compound Name | (5-chlorofuran-2-yl)-(3,4-dichlorophenyl)methanol |
|---|---|
| PubChem CID | 106688862 |
| Molecular Formula | C11H7Cl3O2 |
| Molecular Weight | 277.53 g/mol |
| Exact Mass | 275.95 |
| IUPAC Name | (5-chlorofuran-2-yl)-(3,4-dichlorophenyl)methanol |
| SMILES | OC(c1ccc(Cl)c(Cl)c1)c1ccc(Cl)o1 |
| InChI | InChI=1S/C11H7Cl3O2/c12-7-2-1-6(5-8(7)13)11(15)9-3-4-10(14)16-9/h1-5,11,15H |
| InChIKey | USBJWSJYQKELBX-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.53 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |