C15H13BrCl2O3 — CID 61087950
(2-bromo-4,5-dimethoxyphenyl)-(3,4-dichlorophenyl)methanol (PubChem CID 61087950) has the molecular formula C15H13BrCl2O3 and a molecular weight of 392.08 g/mol. Its IUPAC name is (2-bromo-4,5-dimethoxyphenyl)-(3,4-dichlorophenyl)methanol.
| Compound Name | (2-bromo-4,5-dimethoxyphenyl)-(3,4-dichlorophenyl)methanol |
|---|---|
| PubChem CID | 61087950 |
| Molecular Formula | C15H13BrCl2O3 |
| Molecular Weight | 392.08 g/mol |
| Exact Mass | 389.94 |
| IUPAC Name | (2-bromo-4,5-dimethoxyphenyl)-(3,4-dichlorophenyl)methanol |
| SMILES | COc1cc(Br)c(C(O)c2ccc(Cl)c(Cl)c2)cc1OC |
| InChI | InChI=1S/C15H13BrCl2O3/c1-20-13-6-9(10(16)7-14(13)21-2)15(19)8-3-4-11(17)12(18)5-8/h3-7,15,19H,1-2H3 |
| InChIKey | IMECVNJMAMJBNG-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.08 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |