C15H14Cl2O2 — CID 61081399
(3,4-dichlorophenyl)-(3-methoxy-4-methylphenyl)methanol (PubChem CID 61081399) has the molecular formula C15H14Cl2O2 and a molecular weight of 297.18 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-(3-methoxy-4-methylphenyl)methanol.
| Compound Name | (3,4-dichlorophenyl)-(3-methoxy-4-methylphenyl)methanol |
|---|---|
| PubChem CID | 61081399 |
| Molecular Formula | C15H14Cl2O2 |
| Molecular Weight | 297.18 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | (3,4-dichlorophenyl)-(3-methoxy-4-methylphenyl)methanol |
| SMILES | COc1cc(C(O)c2ccc(Cl)c(Cl)c2)ccc1C |
| InChI | InChI=1S/C15H14Cl2O2/c1-9-3-4-11(8-14(9)19-2)15(18)10-5-6-12(16)13(17)7-10/h3-8,15,18H,1-2H3 |
| InChIKey | CIJHHORMJDIDSF-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.18 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |