C15H11Cl2NO2 — CID 58046334
4-[(3,4-dichlorophenyl)-hydroxymethyl]-3-methoxybenzonitrile (PubChem CID 58046334) has the molecular formula C15H11Cl2NO2 and a molecular weight of 308.16 g/mol. Its IUPAC name is 4-[(3,4-dichlorophenyl)-hydroxymethyl]-3-methoxybenzonitrile.
| Compound Name | 4-[(3,4-dichlorophenyl)-hydroxymethyl]-3-methoxybenzonitrile |
|---|---|
| PubChem CID | 58046334 |
| Molecular Formula | C15H11Cl2NO2 |
| Molecular Weight | 308.16 g/mol |
| Exact Mass | 307.02 |
| IUPAC Name | 4-[(3,4-dichlorophenyl)-hydroxymethyl]-3-methoxybenzonitrile |
| SMILES | COc1cc(C#N)ccc1C(O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H11Cl2NO2/c1-20-14-6-9(8-18)2-4-11(14)15(19)10-3-5-12(16)13(17)7-10/h2-7,15,19H,1H3 |
| InChIKey | XHGPJAXNURBTTN-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.16 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |