C14H11Br2ClO — CID 81324953
(3-chloro-5-methylphenyl)-(2,5-dibromophenyl)methanol (PubChem CID 81324953) has the molecular formula C14H11Br2ClO and a molecular weight of 390.50 g/mol. Its IUPAC name is (3-chloro-5-methylphenyl)-(2,5-dibromophenyl)methanol.
| Compound Name | (3-chloro-5-methylphenyl)-(2,5-dibromophenyl)methanol |
|---|---|
| PubChem CID | 81324953 |
| Molecular Formula | C14H11Br2ClO |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 387.89 |
| IUPAC Name | (3-chloro-5-methylphenyl)-(2,5-dibromophenyl)methanol |
| SMILES | Cc1cc(Cl)cc(C(O)c2cc(Br)ccc2Br)c1 |
| InChI | InChI=1S/C14H11Br2ClO/c1-8-4-9(6-11(17)5-8)14(18)12-7-10(15)2-3-13(12)16/h2-7,14,18H,1H3 |
| InChIKey | QQUFPALVQLPLOZ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |