C11H6BrClF2O2 — CID 107477162
(5-bromofuran-2-yl)-(2-chloro-4,5-difluorophenyl)methanol (PubChem CID 107477162) has the molecular formula C11H6BrClF2O2 and a molecular weight of 323.52 g/mol. Its IUPAC name is (5-bromofuran-2-yl)-(2-chloro-4,5-difluorophenyl)methanol.
| Compound Name | (5-bromofuran-2-yl)-(2-chloro-4,5-difluorophenyl)methanol |
|---|---|
| PubChem CID | 107477162 |
| Molecular Formula | C11H6BrClF2O2 |
| Molecular Weight | 323.52 g/mol |
| Exact Mass | 321.92 |
| IUPAC Name | (5-bromofuran-2-yl)-(2-chloro-4,5-difluorophenyl)methanol |
| SMILES | OC(c1ccc(Br)o1)c1cc(F)c(F)cc1Cl |
| InChI | InChI=1S/C11H6BrClF2O2/c12-10-2-1-9(17-10)11(16)5-3-7(14)8(15)4-6(5)13/h1-4,11,16H |
| InChIKey | GBONWKMCURGHTP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.52 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|