C13H7BrCl2F2O — CID 107991378
(2-bromo-4-chlorophenyl)-(2-chloro-4,5-difluorophenyl)methanol (PubChem CID 107991378) has the molecular formula C13H7BrCl2F2O and a molecular weight of 368.00 g/mol. Its IUPAC name is (2-bromo-4-chlorophenyl)-(2-chloro-4,5-difluorophenyl)methanol.
| Compound Name | (2-bromo-4-chlorophenyl)-(2-chloro-4,5-difluorophenyl)methanol |
|---|---|
| PubChem CID | 107991378 |
| Molecular Formula | C13H7BrCl2F2O |
| Molecular Weight | 368.00 g/mol |
| Exact Mass | 365.90 |
| IUPAC Name | (2-bromo-4-chlorophenyl)-(2-chloro-4,5-difluorophenyl)methanol |
| SMILES | OC(c1cc(F)c(F)cc1Cl)c1ccc(Cl)cc1Br |
| InChI | InChI=1S/C13H7BrCl2F2O/c14-9-3-6(15)1-2-7(9)13(19)8-4-11(17)12(18)5-10(8)16/h1-5,13,19H |
| InChIKey | OGCZMKPZQTUSEH-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.00 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|