C13H5BrClF5 — CID 107477574
1-[bromo-(2-chloro-4,5-difluorophenyl)methyl]-2,3,4-trifluorobenzene (PubChem CID 107477574) has the molecular formula C13H5BrClF5 and a molecular weight of 371.53 g/mol. Its IUPAC name is 1-[bromo-(2-chloro-4,5-difluorophenyl)methyl]-2,3,4-trifluorobenzene.
| Compound Name | 1-[bromo-(2-chloro-4,5-difluorophenyl)methyl]-2,3,4-trifluorobenzene |
|---|---|
| PubChem CID | 107477574 |
| Molecular Formula | C13H5BrClF5 |
| Molecular Weight | 371.53 g/mol |
| Exact Mass | 369.92 |
| IUPAC Name | 1-[bromo-(2-chloro-4,5-difluorophenyl)methyl]-2,3,4-trifluorobenzene |
| SMILES | Fc1cc(Cl)c(C(Br)c2ccc(F)c(F)c2F)cc1F |
| InChI | InChI=1S/C13H5BrClF5/c14-11(5-1-2-8(16)13(20)12(5)19)6-3-9(17)10(18)4-7(6)15/h1-4,11H |
| InChIKey | OMXRARIJCHHKEJ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.53 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|