C13H6BrClF4 — CID 107477452
1-[bromo-(3,5-difluorophenyl)methyl]-2-chloro-4,5-difluorobenzene (PubChem CID 107477452) has the molecular formula C13H6BrClF4 and a molecular weight of 353.54 g/mol. Its IUPAC name is 1-[bromo-(3,5-difluorophenyl)methyl]-2-chloro-4,5-difluorobenzene.
| Compound Name | 1-[bromo-(3,5-difluorophenyl)methyl]-2-chloro-4,5-difluorobenzene |
|---|---|
| PubChem CID | 107477452 |
| Molecular Formula | C13H6BrClF4 |
| Molecular Weight | 353.54 g/mol |
| Exact Mass | 351.93 |
| IUPAC Name | 1-[bromo-(3,5-difluorophenyl)methyl]-2-chloro-4,5-difluorobenzene |
| SMILES | Fc1cc(F)cc(C(Br)c2cc(F)c(F)cc2Cl)c1 |
| InChI | InChI=1S/C13H6BrClF4/c14-13(6-1-7(16)3-8(17)2-6)9-4-11(18)12(19)5-10(9)15/h1-5,13H |
| InChIKey | VZBMFFPDEYAYFE-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.54 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|